Tên IUPAC của (CH3)2CHCH2CH3 là gì?

CH3(CH2)4CH3. Let's analyze each option: (CH3)2CHCH2CH3: This is an isomer of C6H14. (CH3)2CHCH(CH3)2 ... The compound which exhibits optical isomerism is: 1. CH3CHOHCH3 2. (CH3)2CHCH2CH3 3. CH3CHClCH2CH3 4. CH3CCl2CH2CH3 Practice questions, MCQs, ... La masa molar del dióxido de carbono es 12,01 + (2 × 16,00) = 44,01 g/mol. Los pesos de ... 9. MULTIPLE CHOICE. 1 min • 1 pt. Preview. Edit. How many NMR signals would be given by the compound (CH3)2CHCH2CH3. 1. 2. 3. 4. 10. MULTIPLE CHOICE. 30 sec • 1 ... Isobutane ((CH3)2CHCH2CH3), -11.7, −159.42, 58, 75-28-5. Krypton (Kr), −153.415, −157.37, 84, 7439-90-9. Methane (CH4 ), −161.5, −182.50, 16, 74-82-8. Neon (Ne ) ... Jan 21, 2019 ... CH3CH2C(CH3)2CH(CH2CH3)CH3 is 2 ethyl-3,3 dimethyl - pentane and not 3-methyl-4,4-dimethylhexane. When I expand the condensed formula above and count the ... Jan 1, 2020 ... (CH3)2CHCH2CH3. Molecular weight g/mol. 72.15. Boiling point initial, at 1.013 bar. °C. 27.8. Liquid density at 20°C at 50°C kg/dm. 3 kg/dm. 3. Justification: 9) Cr or Si. Justification: 10) H2O or SiO2. Justification: 11) MgO or BaO. Justification: 12) CH3CH2CH2CH2CH3 or (CH3)2CHCH2CH3. Justification: 2.2 Formula: (CH3)2CHCH2CH3. 2.3 IMO/UN Designation: 3.1/1265. 2.4 DOT ID No.: 1265. 2.5 CAS Registry No.: 78-78-4. 2.6 NAERG Guide No.: 128. 2.7 Standard ... Briefly explain your choice. CH3CH2CH2CH2CH3 or (CH3)2CHCH2CH3. CH3CH2CH2CH2CH3 has the higher boiling point. As the degree of branching increases, the ...